C13H18N6O2 — CID 103126798
methyl 1-[(3-methylimidazol-4-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate (PubChem CID 103126798) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is methyl 1-[(3-methylimidazol-4-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate.
| Compound Name | methyl 1-[(3-methylimidazol-4-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103126798 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | methyl 1-[(3-methylimidazol-4-yl)methyl]-5-pyrrolidin-2-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(Cc2cncn2C)c1C1CCCN1 |
| InChI | InChI=1S/C13H18N6O2/c1-18-8-14-6-9(18)7-19-12(10-4-3-5-15-10)11(16-17-19)13(20)21-2/h6,8,10,15H,3-5,7H2,1-2H3 |
| InChIKey | FDOWNOXVFWMPAX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |