C12H19N5O3 — CID 103123641
methyl 1-(3-amino-3-oxopropyl)-5-piperidin-4-yltriazole-4-carboxylate (PubChem CID 103123641) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is methyl 1-(3-amino-3-oxopropyl)-5-piperidin-4-yltriazole-4-carboxylate.
| Compound Name | methyl 1-(3-amino-3-oxopropyl)-5-piperidin-4-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103123641 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | methyl 1-(3-amino-3-oxopropyl)-5-piperidin-4-yltriazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CCC(N)=O)c1C1CCNCC1 |
| InChI | InChI=1S/C12H19N5O3/c1-20-12(19)10-11(8-2-5-14-6-3-8)17(16-15-10)7-4-9(13)18/h8,14H,2-7H2,1H3,(H2,13,18) |
| InChIKey | JTYOWQMILYLLLB-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |