C10H13NO2S — CID 130001149
methyl 5-pyrrolidin-2-ylthiophene-2-carboxylate (PubChem CID 130001149) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is methyl 5-pyrrolidin-2-ylthiophene-2-carboxylate.
| Compound Name | methyl 5-pyrrolidin-2-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 130001149 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | methyl 5-pyrrolidin-2-ylthiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C2CCCN2)s1 |
| InChI | InChI=1S/C10H13NO2S/c1-13-10(12)9-5-4-8(14-9)7-3-2-6-11-7/h4-5,7,11H,2-3,6H2,1H3 |
| InChIKey | DPUGWQFBYPFMQG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |