C14H15N3O2S — CID 166305537
N-(6-oxo-1H-pyridin-3-yl)-5-pyrrolidin-2-ylthiophene-2-carboxamide (PubChem CID 166305537) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(6-oxo-1H-pyridin-3-yl)-5-pyrrolidin-2-ylthiophene-2-carboxamide.
| Compound Name | N-(6-oxo-1H-pyridin-3-yl)-5-pyrrolidin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 166305537 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(6-oxo-1H-pyridin-3-yl)-5-pyrrolidin-2-ylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]c1)c1ccc(C2CCCN2)s1 |
| InChI | InChI=1S/C14H15N3O2S/c18-13-6-3-9(8-16-13)17-14(19)12-5-4-11(20-12)10-2-1-7-15-10/h3-6,8,10,15H,1-2,7H2,(H,16,18)(H,17,19) |
| InChIKey | ISOWGQQAVUVBHA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |