C20H20N4O2S — CID 166261151
N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-5-pyrrolidin-2-ylthiophene-2-carboxamide (PubChem CID 166261151) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-5-pyrrolidin-2-ylthiophene-2-carboxamide.
| Compound Name | N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-5-pyrrolidin-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 166261151 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-5-pyrrolidin-2-ylthiophene-2-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(-c2cccc(NC(=O)c3ccc(C4CCCN4)s3)c2)n1 |
| InChI | InChI=1S/C20H20N4O2S/c1-12-10-18(25)24-19(22-12)13-4-2-5-14(11-13)23-20(26)17-8-7-16(27-17)15-6-3-9-21-15/h2,4-5,7-8,10-11,15,21H,3,6,9H2,1H3,(H,23,26)(H,22,24,25) |
| InChIKey | YZHUMZBXUFIAON-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |