C22H17N3O4 — CID 136512991
4-methyl-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 136512991) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 4-methyl-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 136512991 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 4-methyl-N-[3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(-c2cccc(NC(=O)c3c(C)c4ccccc4oc3=O)c2)n1 |
| InChI | InChI=1S/C22H17N3O4/c1-12-10-18(26)25-20(23-12)14-6-5-7-15(11-14)24-21(27)19-13(2)16-8-3-4-9-17(16)29-22(19)28/h3-11H,1-2H3,(H,24,27)(H,23,25,26) |
| InChIKey | YZHDYJLLZOFANF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|