C13H17N5O3 — CID 103116687
ethyl 5-(1-methylimidazol-2-yl)-1-(oxolan-3-yl)triazole-4-carboxylate (PubChem CID 103116687) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is ethyl 5-(1-methylimidazol-2-yl)-1-(oxolan-3-yl)triazole-4-carboxylate.
| Compound Name | ethyl 5-(1-methylimidazol-2-yl)-1-(oxolan-3-yl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103116687 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | ethyl 5-(1-methylimidazol-2-yl)-1-(oxolan-3-yl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C2CCOC2)c1-c1nccn1C |
| InChI | InChI=1S/C13H17N5O3/c1-3-21-13(19)10-11(12-14-5-6-17(12)2)18(16-15-10)9-4-7-20-8-9/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | DFBXFRKHFITTNY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |