C14H17N3O3S — CID 107137401
ethyl 1-(oxan-3-yl)-5-thiophen-2-yltriazole-4-carboxylate (PubChem CID 107137401) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is ethyl 1-(oxan-3-yl)-5-thiophen-2-yltriazole-4-carboxylate.
| Compound Name | ethyl 1-(oxan-3-yl)-5-thiophen-2-yltriazole-4-carboxylate |
|---|---|
| PubChem CID | 107137401 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | ethyl 1-(oxan-3-yl)-5-thiophen-2-yltriazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(C2CCCOC2)c1-c1cccs1 |
| InChI | InChI=1S/C14H17N3O3S/c1-2-20-14(18)12-13(11-6-4-8-21-11)17(16-15-12)10-5-3-7-19-9-10/h4,6,8,10H,2-3,5,7,9H2,1H3 |
| InChIKey | HVIPHFJCBMCLKV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |