About ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate
ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate (PubChem CID 83232663) has the molecular formula C11H17N3O3
and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate.
Analyze ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate?
The IUPAC name of ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate (CID 83232663) is ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate?
The canonical SMILES for ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate is CCOC(=O)c1nnc(C)n1C1CCCOC1.
What is the InChIKey of ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate?
The InChIKey is DLQDNQYSGQMVMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3/c1-3-17-11(15)10-13-12-8(2)14(10)9-5-4-6-16-7-9/h9H,3-7H2,1-2H3.
What are the key properties of ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate?
ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate has a molecular weight of 239.27 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-methyl-4-(oxan-3-yl)-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 83232663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).