C13H18N4O — CID 103117272
N-methyl-N-[3-(methylamino)propyl]pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 103117272) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is N-methyl-N-[3-(methylamino)propyl]pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-methyl-N-[3-(methylamino)propyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103117272 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-methyl-N-[3-(methylamino)propyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CNCCCN(C)C(=O)c1cnn2ccccc12 |
| InChI | InChI=1S/C13H18N4O/c1-14-7-5-8-16(2)13(18)11-10-15-17-9-4-3-6-12(11)17/h3-4,6,9-10,14H,5,7-8H2,1-2H3 |
| InChIKey | DUEHBJONHNKESH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|