C12H14BrN3O — CID 103122839
N-(1-bromopropan-2-yl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 103122839) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(1-bromopropan-2-yl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103122839 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-(1-bromopropan-2-yl)-N-methylpyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC(CBr)N(C)C(=O)c1cnn2ccccc12 |
| InChI | InChI=1S/C12H14BrN3O/c1-9(7-13)15(2)12(17)10-8-14-16-6-4-3-5-11(10)16/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | KQDLRYWSHKVGPM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|