C13H21N5 — CID 103117611
N'-(2-methylpropyl)-N-(pyrazolo[1,5-a]pyrazin-3-ylmethyl)ethane-1,2-diamine (PubChem CID 103117611) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N'-(2-methylpropyl)-N-(pyrazolo[1,5-a]pyrazin-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(2-methylpropyl)-N-(pyrazolo[1,5-a]pyrazin-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 103117611 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N'-(2-methylpropyl)-N-(pyrazolo[1,5-a]pyrazin-3-ylmethyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCNCc1cnn2ccncc12 |
| InChI | InChI=1S/C13H21N5/c1-11(2)7-14-3-4-15-8-12-9-17-18-6-5-16-10-13(12)18/h5-6,9-11,14-15H,3-4,7-8H2,1-2H3 |
| InChIKey | CMLXUICVJLKMGZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|