C12H18N4 — CID 103126804
3-methyl-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine (PubChem CID 103126804) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-methyl-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine.
| Compound Name | 3-methyl-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine |
|---|---|
| PubChem CID | 103126804 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-methyl-1-pyrazolo[1,5-a]pyrazin-3-ylpentan-1-amine |
| SMILES | CCC(C)CC(N)c1cnn2ccncc12 |
| InChI | InChI=1S/C12H18N4/c1-3-9(2)6-11(13)10-7-15-16-5-4-14-8-12(10)16/h4-5,7-9,11H,3,6,13H2,1-2H3 |
| InChIKey | GCMTXGHESMSGPI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |