C11H13N5 — CID 103129490
1-pyrazolo[1,5-a]pyrazin-3-ylpent-3-ynylhydrazine (PubChem CID 103129490) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrazin-3-ylpent-3-ynylhydrazine.
| Compound Name | 1-pyrazolo[1,5-a]pyrazin-3-ylpent-3-ynylhydrazine |
|---|---|
| PubChem CID | 103129490 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyrazin-3-ylpent-3-ynylhydrazine |
| SMILES | CC#CCC(NN)c1cnn2ccncc12 |
| InChI | InChI=1S/C11H13N5/c1-2-3-4-10(15-12)9-7-14-16-6-5-13-8-11(9)16/h5-8,10,15H,4,12H2,1H3 |
| InChIKey | VKHLEBPFHXCGGO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|