C10H13N5 — CID 103129481
1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-enylhydrazine (PubChem CID 103129481) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-enylhydrazine.
| Compound Name | 1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-enylhydrazine |
|---|---|
| PubChem CID | 103129481 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyrazin-3-ylbut-3-enylhydrazine |
| SMILES | C=CCC(NN)c1cnn2ccncc12 |
| InChI | InChI=1S/C10H13N5/c1-2-3-9(14-11)8-6-13-15-5-4-12-7-10(8)15/h2,4-7,9,14H,1,3,11H2 |
| InChIKey | XOOLWVLBWKKKOZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|