C14H14BrN5 — CID 103129414
[2-(4-bromophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethyl]hydrazine (PubChem CID 103129414) has the molecular formula C14H14BrN5 and a molecular weight of 332.21 g/mol. Its IUPAC name is [2-(4-bromophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethyl]hydrazine.
| Compound Name | [2-(4-bromophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 103129414 |
| Molecular Formula | C14H14BrN5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [2-(4-bromophenyl)-1-pyrazolo[1,5-a]pyrazin-3-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Br)cc1)c1cnn2ccncc12 |
| InChI | InChI=1S/C14H14BrN5/c15-11-3-1-10(2-4-11)7-13(19-16)12-8-18-20-6-5-17-9-14(12)20/h1-6,8-9,13,19H,7,16H2 |
| InChIKey | XVXZBJXUAZALAZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|