C14H16N4O — CID 103117767
N-(2-cyanopropyl)-N,1-dimethylindazole-3-carboxamide (PubChem CID 103117767) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(2-cyanopropyl)-N,1-dimethylindazole-3-carboxamide.
| Compound Name | N-(2-cyanopropyl)-N,1-dimethylindazole-3-carboxamide |
|---|---|
| PubChem CID | 103117767 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-(2-cyanopropyl)-N,1-dimethylindazole-3-carboxamide |
| SMILES | CC(C#N)CN(C)C(=O)c1nn(C)c2ccccc12 |
| InChI | InChI=1S/C14H16N4O/c1-10(8-15)9-17(2)14(19)13-11-6-4-5-7-12(11)18(3)16-13/h4-7,10H,9H2,1-3H3 |
| InChIKey | XXHGKRTYUGINEX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |