C13H14BrF2N3O — CID 107491860
N-(2-bromoethyl)-N-(2,2-difluoroethyl)-1-methylindazole-3-carboxamide (PubChem CID 107491860) has the molecular formula C13H14BrF2N3O and a molecular weight of 346.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2-difluoroethyl)-1-methylindazole-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-1-methylindazole-3-carboxamide |
|---|---|
| PubChem CID | 107491860 |
| Molecular Formula | C13H14BrF2N3O |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2-difluoroethyl)-1-methylindazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)N(CCBr)CC(F)F)c2ccccc21 |
| InChI | InChI=1S/C13H14BrF2N3O/c1-18-10-5-3-2-4-9(10)12(17-18)13(20)19(7-6-14)8-11(15)16/h2-5,11H,6-8H2,1H3 |
| InChIKey | MZDMDIWBOTXVOQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|