C11H20N4O — CID 103123157
N-(4-amino-2-ethylbutyl)-1-methylpyrazole-3-carboxamide (PubChem CID 103123157) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-(4-amino-2-ethylbutyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-amino-2-ethylbutyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103123157 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-(4-amino-2-ethylbutyl)-1-methylpyrazole-3-carboxamide |
| SMILES | CCC(CCN)CNC(=O)c1ccn(C)n1 |
| InChI | InChI=1S/C11H20N4O/c1-3-9(4-6-12)8-13-11(16)10-5-7-15(2)14-10/h5,7,9H,3-4,6,8,12H2,1-2H3,(H,13,16) |
| InChIKey | FQMLZXUGJZMKPW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |