C8H13N3O3 — CID 103125914
N-(2-methoxyethyl)-2-(2-oxo-1H-imidazol-3-yl)acetamide (PubChem CID 103125914) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(2-oxo-1H-imidazol-3-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(2-oxo-1H-imidazol-3-yl)acetamide |
|---|---|
| PubChem CID | 103125914 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-(2-oxo-1H-imidazol-3-yl)acetamide |
| SMILES | COCCNC(=O)Cn1cc[nH]c1=O |
| InChI | InChI=1S/C8H13N3O3/c1-14-5-3-9-7(12)6-11-4-2-10-8(11)13/h2,4H,3,5-6H2,1H3,(H,9,12)(H,10,13) |
| InChIKey | XWPISRDHOLRBIG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|