C11H16BrN3O3 — CID 104505729
2-(5-amino-3-bromo-4-methyl-2-oxo-1-pyridinyl)-N-(2-methoxyethyl)acetamide (PubChem CID 104505729) has the molecular formula C11H16BrN3O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-(5-amino-3-bromo-4-methyl-2-oxo-1-pyridinyl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(5-amino-3-bromo-4-methyl-2-oxo-1-pyridinyl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 104505729 |
| Molecular Formula | C11H16BrN3O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-(5-amino-3-bromo-4-methyl-2-oxo-1-pyridinyl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cc(N)c(C)c(Br)c1=O |
| InChI | InChI=1S/C11H16BrN3O3/c1-7-8(13)5-15(11(17)10(7)12)6-9(16)14-3-4-18-2/h5H,3-4,6,13H2,1-2H3,(H,14,16) |
| InChIKey | QQUUSASNQHFSKM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|