C14H13N3 — CID 103125948
phenyl(pyrazolo[1,5-a]pyridin-3-yl)methanamine (PubChem CID 103125948) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is phenyl(pyrazolo[1,5-a]pyridin-3-yl)methanamine.
| Compound Name | phenyl(pyrazolo[1,5-a]pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 103125948 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | phenyl(pyrazolo[1,5-a]pyridin-3-yl)methanamine |
| SMILES | NC(c1ccccc1)c1cnn2ccccc12 |
| InChI | InChI=1S/C14H13N3/c15-14(11-6-2-1-3-7-11)12-10-16-17-9-5-4-8-13(12)17/h1-10,14H,15H2 |
| InChIKey | SNESNVKIUVHXEK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |