C12H16N2O — CID 103128474
3-methyl-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-ol (PubChem CID 103128474) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-methyl-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-ol.
| Compound Name | 3-methyl-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-ol |
|---|---|
| PubChem CID | 103128474 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-methyl-1-pyrazolo[1,5-a]pyridin-3-ylbutan-1-ol |
| SMILES | CC(C)CC(O)c1cnn2ccccc12 |
| InChI | InChI=1S/C12H16N2O/c1-9(2)7-12(15)10-8-13-14-6-4-3-5-11(10)14/h3-6,8-9,12,15H,7H2,1-2H3 |
| InChIKey | ZYLKDMRSQGVQBB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |