C39H33Cl2N3O7S — CID 10312695
4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-chloro-2-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid (PubChem CID 10312695) has the molecular formula C39H33Cl2N3O7S and a molecular weight of 758.68 g/mol. Its IUPAC name is 4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-chloro-2-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid.
| Compound Name | 4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-chloro-2-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 10312695 |
| Molecular Formula | C39H33Cl2N3O7S |
| Molecular Weight | 758.68 g/mol |
| Exact Mass | 757.14 |
| IUPAC Name | 4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-chloro-2-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCc2c(CCNS(=O)(=O)Cc3ccc(Cl)cc3[N+](=O)[O-])n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C39H33Cl2N3O7S/c40-30-15-18-35-34(23-30)33(20-22-51-32-16-12-28(13-17-32)39(45)46)36(43(35)38(26-7-3-1-4-8-26)27-9-5-2-6-10-27)19-21-42-52(49,50)25-29-11-14-31(41)24-37(29)44(47)48/h1-18,23-24,38,42H,19-22,25H2,(H,45,46) |
| InChIKey | WHXWYUUNFUXOHO-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.68 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|