C39H34ClN3O7S — CID 10240424
4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid (PubChem CID 10240424) has the molecular formula C39H34ClN3O7S and a molecular weight of 724.24 g/mol. Its IUPAC name is 4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid.
| Compound Name | 4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 10240424 |
| Molecular Formula | C39H34ClN3O7S |
| Molecular Weight | 724.24 g/mol |
| Exact Mass | 723.18 |
| IUPAC Name | 4-[2-[1-benzhydryl-5-chloro-2-[2-[(4-nitrophenyl)methylsulfonylamino]ethyl]indol-3-yl]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCc2c(CCNS(=O)(=O)Cc3ccc([N+](=O)[O-])cc3)n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C39H34ClN3O7S/c40-31-15-20-36-35(25-31)34(22-24-50-33-18-13-30(14-19-33)39(44)45)37(21-23-41-51(48,49)26-27-11-16-32(17-12-27)43(46)47)42(36)38(28-7-3-1-4-8-28)29-9-5-2-6-10-29/h1-20,25,38,41H,21-24,26H2,(H,44,45) |
| InChIKey | LZOTUWOIQAPOQN-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.24 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|