C34H32ClNO3 — CID 11692341
methyl 3-[4-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethoxy]phenyl]propanoate (PubChem CID 11692341) has the molecular formula C34H32ClNO3 and a molecular weight of 538.09 g/mol. Its IUPAC name is methyl 3-[4-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 11692341 |
| Molecular Formula | C34H32ClNO3 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | methyl 3-[4-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCCc2c(C)n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C34H32ClNO3/c1-24-30(21-22-39-29-17-13-25(14-18-29)15-20-33(37)38-2)31-23-28(35)16-19-32(31)36(24)34(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-14,16-19,23,34H,15,20-22H2,1-2H3 |
| InChIKey | HLRLEFNGYGGCRV-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |