C51H52ClNO5SSi — CID 68983922
methyl 3-[4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethylsulfonyl]phenyl]propanoate (PubChem CID 68983922) has the molecular formula C51H52ClNO5SSi and a molecular weight of 854.59 g/mol. Its IUPAC name is methyl 3-[4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethylsulfonyl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethylsulfonyl]phenyl]propanoate |
|---|---|
| PubChem CID | 68983922 |
| Molecular Formula | C51H52ClNO5SSi |
| Molecular Weight | 854.59 g/mol |
| Exact Mass | 853.30 |
| IUPAC Name | methyl 3-[4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethylsulfonyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(S(=O)(=O)CCc2c(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C51H52ClNO5SSi/c1-51(2,3)60(43-21-13-7-14-22-43,44-23-15-8-16-24-44)58-35-33-48-45(34-36-59(55,56)42-29-25-38(26-30-42)27-32-49(54)57-4)46-37-41(52)28-31-47(46)53(48)50(39-17-9-5-10-18-39)40-19-11-6-12-20-40/h5-26,28-31,37,50H,27,32-36H2,1-4H3 |
| InChIKey | ILQCSROXDPZIGV-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.59 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|