C52H54ClNO5Si — CID 67055459
methyl 4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethoxy]-2-propan-2-yloxybenzoate (PubChem CID 67055459) has the molecular formula C52H54ClNO5Si and a molecular weight of 836.55 g/mol. Its IUPAC name is methyl 4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethoxy]-2-propan-2-yloxybenzoate.
| Compound Name | methyl 4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethoxy]-2-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 67055459 |
| Molecular Formula | C52H54ClNO5Si |
| Molecular Weight | 836.55 g/mol |
| Exact Mass | 835.35 |
| IUPAC Name | methyl 4-[2-[1-benzhydryl-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-chloroindol-3-yl]ethoxy]-2-propan-2-yloxybenzoate |
| SMILES | COC(=O)c1ccc(OCCc2c(CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1OC(C)C |
| InChI | InChI=1S/C52H54ClNO5Si/c1-37(2)59-49-36-41(28-29-45(49)51(55)56-6)57-33-31-44-46-35-40(53)27-30-47(46)54(50(38-19-11-7-12-20-38)39-21-13-8-14-22-39)48(44)32-34-58-60(52(3,4)5,42-23-15-9-16-24-42)43-25-17-10-18-26-43/h7-30,35-37,50H,31-34H2,1-6H3 |
| InChIKey | PIINRTCRNKYKFD-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.55 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|