C34H32ClNO3S — CID 11527031
methyl 4-[2-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethylsulfinyl]ethyl]benzoate (PubChem CID 11527031) has the molecular formula C34H32ClNO3S and a molecular weight of 570.15 g/mol. Its IUPAC name is methyl 4-[2-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethylsulfinyl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethylsulfinyl]ethyl]benzoate |
|---|---|
| PubChem CID | 11527031 |
| Molecular Formula | C34H32ClNO3S |
| Molecular Weight | 570.15 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | methyl 4-[2-[2-(1-benzhydryl-5-chloro-2-methylindol-3-yl)ethylsulfinyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCS(=O)CCc2c(C)n(C(c3ccccc3)c3ccccc3)c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C34H32ClNO3S/c1-24-30(20-22-40(38)21-19-25-13-15-28(16-14-25)34(37)39-2)31-23-29(35)17-18-32(31)36(24)33(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-18,23,33H,19-22H2,1-2H3 |
| InChIKey | JPTWTUPINJEMOB-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.15 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |