C32H28ClNO4 — CID 11584505
methyl 4-[3-(1-benzhydryl-6-chloroindol-3-yl)-2-hydroxypropoxy]benzoate (PubChem CID 11584505) has the molecular formula C32H28ClNO4 and a molecular weight of 526.03 g/mol. Its IUPAC name is methyl 4-[3-(1-benzhydryl-6-chloroindol-3-yl)-2-hydroxypropoxy]benzoate.
| Compound Name | methyl 4-[3-(1-benzhydryl-6-chloroindol-3-yl)-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 11584505 |
| Molecular Formula | C32H28ClNO4 |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | methyl 4-[3-(1-benzhydryl-6-chloroindol-3-yl)-2-hydroxypropoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(O)Cc2cn(C(c3ccccc3)c3ccccc3)c3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C32H28ClNO4/c1-37-32(36)24-12-15-28(16-13-24)38-21-27(35)18-25-20-34(30-19-26(33)14-17-29(25)30)31(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-17,19-20,27,31,35H,18,21H2,1H3 |
| InChIKey | PWBWYQOTQMZVOT-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |