C32H29NO4S — CID 11706339
methyl 4-[2-(1-benzhydryl-2-methylindol-3-yl)ethylsulfonyl]benzoate (PubChem CID 11706339) has the molecular formula C32H29NO4S and a molecular weight of 523.65 g/mol. Its IUPAC name is methyl 4-[2-(1-benzhydryl-2-methylindol-3-yl)ethylsulfonyl]benzoate.
| Compound Name | methyl 4-[2-(1-benzhydryl-2-methylindol-3-yl)ethylsulfonyl]benzoate |
|---|---|
| PubChem CID | 11706339 |
| Molecular Formula | C32H29NO4S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | methyl 4-[2-(1-benzhydryl-2-methylindol-3-yl)ethylsulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)CCc2c(C)n(C(c3ccccc3)c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C32H29NO4S/c1-23-28(21-22-38(35,36)27-19-17-26(18-20-27)32(34)37-2)29-15-9-10-16-30(29)33(23)31(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-20,31H,21-22H2,1-2H3 |
| InChIKey | WUJDQINJHGJMBX-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |