C10H11NaO7S2 — CID 139892694
sodium 2-(4-methoxycarbonylphenyl)sulfonylethanesulfonate (PubChem CID 139892694) has the molecular formula C10H11NaO7S2 and a molecular weight of 330.31 g/mol. Its IUPAC name is sodium 2-(4-methoxycarbonylphenyl)sulfonylethanesulfonate.
| Compound Name | sodium 2-(4-methoxycarbonylphenyl)sulfonylethanesulfonate |
|---|---|
| PubChem CID | 139892694 |
| Molecular Formula | C10H11NaO7S2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | sodium 2-(4-methoxycarbonylphenyl)sulfonylethanesulfonate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)CCS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C10H12O7S2.Na/c1-17-10(11)8-2-4-9(5-3-8)18(12,13)6-7-19(14,15)16;/h2-5H,6-7H2,1H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | RMSQHKHUFQAFLZ-UHFFFAOYSA-M |
| XLogP | -3.20 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|