C9H8Br2N2O2 — CID 103130127
(4,5-dibromofuran-2-yl)-(1-methylpyrazol-3-yl)methanol (PubChem CID 103130127) has the molecular formula C9H8Br2N2O2 and a molecular weight of 335.98 g/mol. Its IUPAC name is (4,5-dibromofuran-2-yl)-(1-methylpyrazol-3-yl)methanol.
| Compound Name | (4,5-dibromofuran-2-yl)-(1-methylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 103130127 |
| Molecular Formula | C9H8Br2N2O2 |
| Molecular Weight | 335.98 g/mol |
| Exact Mass | 333.90 |
| IUPAC Name | (4,5-dibromofuran-2-yl)-(1-methylpyrazol-3-yl)methanol |
| SMILES | Cn1ccc(C(O)c2cc(Br)c(Br)o2)n1 |
| InChI | InChI=1S/C9H8Br2N2O2/c1-13-3-2-6(12-13)8(14)7-4-5(10)9(11)15-7/h2-4,8,14H,1H3 |
| InChIKey | ASRLKZHEEVEIMF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.98 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |