C10H10Br2N2O2 — CID 63893672
(4,5-dibromofuran-2-yl)-(1-ethylpyrazol-4-yl)methanol (PubChem CID 63893672) has the molecular formula C10H10Br2N2O2 and a molecular weight of 350.01 g/mol. Its IUPAC name is (4,5-dibromofuran-2-yl)-(1-ethylpyrazol-4-yl)methanol.
| Compound Name | (4,5-dibromofuran-2-yl)-(1-ethylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 63893672 |
| Molecular Formula | C10H10Br2N2O2 |
| Molecular Weight | 350.01 g/mol |
| Exact Mass | 347.91 |
| IUPAC Name | (4,5-dibromofuran-2-yl)-(1-ethylpyrazol-4-yl)methanol |
| SMILES | CCn1cc(C(O)c2cc(Br)c(Br)o2)cn1 |
| InChI | InChI=1S/C10H10Br2N2O2/c1-2-14-5-6(4-13-14)9(15)8-3-7(11)10(12)16-8/h3-5,9,15H,2H2,1H3 |
| InChIKey | WJKBVNTUPPFSHP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.01 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |