C10H10Br2N2OS — CID 107969580
(2,5-dibromothiophen-3-yl)-(1-ethylpyrazol-4-yl)methanol (PubChem CID 107969580) has the molecular formula C10H10Br2N2OS and a molecular weight of 366.08 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(1-ethylpyrazol-4-yl)methanol.
| Compound Name | (2,5-dibromothiophen-3-yl)-(1-ethylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 107969580 |
| Molecular Formula | C10H10Br2N2OS |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 363.89 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(1-ethylpyrazol-4-yl)methanol |
| SMILES | CCn1cc(C(O)c2cc(Br)sc2Br)cn1 |
| InChI | InChI=1S/C10H10Br2N2OS/c1-2-14-5-6(4-13-14)9(15)7-3-8(11)16-10(7)12/h3-5,9,15H,2H2,1H3 |
| InChIKey | HJDHUJBLQWVEOI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |