C12H12F2N2O — CID 63083868
(2,4-difluorophenyl)-(1-ethylpyrazol-4-yl)methanol (PubChem CID 63083868) has the molecular formula C12H12F2N2O and a molecular weight of 238.24 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(1-ethylpyrazol-4-yl)methanol.
| Compound Name | (2,4-difluorophenyl)-(1-ethylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 63083868 |
| Molecular Formula | C12H12F2N2O |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (2,4-difluorophenyl)-(1-ethylpyrazol-4-yl)methanol |
| SMILES | CCn1cc(C(O)c2ccc(F)cc2F)cn1 |
| InChI | InChI=1S/C12H12F2N2O/c1-2-16-7-8(6-15-16)12(17)10-4-3-9(13)5-11(10)14/h3-7,12,17H,2H2,1H3 |
| InChIKey | JBGIGHSMTBWCQX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |