C15H19N3O — CID 103130128
(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-(1-methylpyrazol-3-yl)methanol (PubChem CID 103130128) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (1-methyl-3,4-dihydro-2H-quinolin-6-yl)-(1-methylpyrazol-3-yl)methanol.
| Compound Name | (1-methyl-3,4-dihydro-2H-quinolin-6-yl)-(1-methylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 103130128 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (1-methyl-3,4-dihydro-2H-quinolin-6-yl)-(1-methylpyrazol-3-yl)methanol |
| SMILES | CN1CCCc2cc(C(O)c3ccn(C)n3)ccc21 |
| InChI | InChI=1S/C15H19N3O/c1-17-8-3-4-11-10-12(5-6-14(11)17)15(19)13-7-9-18(2)16-13/h5-7,9-10,15,19H,3-4,8H2,1-2H3 |
| InChIKey | XUTLLVGSFJCNLH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|