C10H18N2O — CID 103130270
3,3-dimethyl-2-(1-methylpyrazol-3-yl)butan-2-ol (PubChem CID 103130270) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 3,3-dimethyl-2-(1-methylpyrazol-3-yl)butan-2-ol.
| Compound Name | 3,3-dimethyl-2-(1-methylpyrazol-3-yl)butan-2-ol |
|---|---|
| PubChem CID | 103130270 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3,3-dimethyl-2-(1-methylpyrazol-3-yl)butan-2-ol |
| SMILES | Cn1ccc(C(C)(O)C(C)(C)C)n1 |
| InChI | InChI=1S/C10H18N2O/c1-9(2,3)10(4,13)8-6-7-12(5)11-8/h6-7,13H,1-5H3 |
| InChIKey | ZBNQBMRZMBYHMW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |