C11H20N2O — CID 130529005
2,4-dimethyl-3-(1-methylpyrazol-3-yl)pentan-3-ol (PubChem CID 130529005) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 2,4-dimethyl-3-(1-methylpyrazol-3-yl)pentan-3-ol.
| Compound Name | 2,4-dimethyl-3-(1-methylpyrazol-3-yl)pentan-3-ol |
|---|---|
| PubChem CID | 130529005 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2,4-dimethyl-3-(1-methylpyrazol-3-yl)pentan-3-ol |
| SMILES | CC(C)C(O)(c1ccn(C)n1)C(C)C |
| InChI | InChI=1S/C11H20N2O/c1-8(2)11(14,9(3)4)10-6-7-13(5)12-10/h6-9,14H,1-5H3 |
| InChIKey | DTTTUKRYKMSXAF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |