C15H26N4O — CID 103131121
N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(1-methylpyrazol-3-yl)methyl]propan-1-amine (PubChem CID 103131121) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(1-methylpyrazol-3-yl)methyl]propan-1-amine.
| Compound Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(1-methylpyrazol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 103131121 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(1-methylpyrazol-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccn(C)n1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H26N4O/c1-3-7-16-15(13-6-9-18(2)17-13)14-10-19-8-4-5-12(19)11-20-14/h6,9,12,14-16H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | ZZDZFRONAVTUQY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |