C14H24BrN5O — CID 106462691
N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(5-bromo-3-methyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 106462691) has the molecular formula C14H24BrN5O and a molecular weight of 358.28 g/mol. Its IUPAC name is N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(5-bromo-3-methyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(5-bromo-3-methyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106462691 |
| Molecular Formula | C14H24BrN5O |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(5-bromo-3-methyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1c(Br)nnn1C)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H24BrN5O/c1-3-6-16-12(13-14(15)17-18-19(13)2)11-8-20-7-4-5-10(20)9-21-11/h10-12,16H,3-9H2,1-2H3 |
| InChIKey | KBADRGASGULEQG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |