C10H19N3O2 — CID 103131136
2,2-diethoxy-1-(1-methylpyrazol-3-yl)ethanamine (PubChem CID 103131136) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2,2-diethoxy-1-(1-methylpyrazol-3-yl)ethanamine.
| Compound Name | 2,2-diethoxy-1-(1-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 103131136 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,2-diethoxy-1-(1-methylpyrazol-3-yl)ethanamine |
| SMILES | CCOC(OCC)C(N)c1ccn(C)n1 |
| InChI | InChI=1S/C10H19N3O2/c1-4-14-10(15-5-2)9(11)8-6-7-13(3)12-8/h6-7,9-10H,4-5,11H2,1-3H3 |
| InChIKey | SRJZXZDNRXZTDU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|