C9H18N4O — CID 105228844
[1-(1-methylpyrazol-3-yl)-2-propan-2-yloxyethyl]hydrazine (PubChem CID 105228844) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is [1-(1-methylpyrazol-3-yl)-2-propan-2-yloxyethyl]hydrazine.
| Compound Name | [1-(1-methylpyrazol-3-yl)-2-propan-2-yloxyethyl]hydrazine |
|---|---|
| PubChem CID | 105228844 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | [1-(1-methylpyrazol-3-yl)-2-propan-2-yloxyethyl]hydrazine |
| SMILES | CC(C)OCC(NN)c1ccn(C)n1 |
| InChI | InChI=1S/C9H18N4O/c1-7(2)14-6-9(11-10)8-4-5-13(3)12-8/h4-5,7,9,11H,6,10H2,1-3H3 |
| InChIKey | MNPSKQQHHURRQP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|