C9H13N5S — CID 105228809
[1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105228809) has the molecular formula C9H13N5S and a molecular weight of 223.31 g/mol. Its IUPAC name is [1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105228809 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | [1-(1-methylpyrazol-3-yl)-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | Cn1ccc(C(Cc2nccs2)NN)n1 |
| InChI | InChI=1S/C9H13N5S/c1-14-4-2-7(13-14)8(12-10)6-9-11-3-5-15-9/h2-5,8,12H,6,10H2,1H3 |
| InChIKey | DINYGFWTYASTDU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|