C12H23N3O — CID 103134564
N-ethyl-1-(1-methylpyrazol-3-yl)-3-propoxypropan-1-amine (PubChem CID 103134564) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-ethyl-1-(1-methylpyrazol-3-yl)-3-propoxypropan-1-amine.
| Compound Name | N-ethyl-1-(1-methylpyrazol-3-yl)-3-propoxypropan-1-amine |
|---|---|
| PubChem CID | 103134564 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-ethyl-1-(1-methylpyrazol-3-yl)-3-propoxypropan-1-amine |
| SMILES | CCCOCCC(NCC)c1ccn(C)n1 |
| InChI | InChI=1S/C12H23N3O/c1-4-9-16-10-7-11(13-5-2)12-6-8-15(3)14-12/h6,8,11,13H,4-5,7,9-10H2,1-3H3 |
| InChIKey | IZZHVIFFIFGSNQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|