C20H26FNO — CID 10313625
4-(3-tert-butylphenoxy)-1-(4-fluorophenyl)butan-1-amine (PubChem CID 10313625) has the molecular formula C20H26FNO and a molecular weight of 315.43 g/mol. Its IUPAC name is 4-(3-tert-butylphenoxy)-1-(4-fluorophenyl)butan-1-amine.
| Compound Name | 4-(3-tert-butylphenoxy)-1-(4-fluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 10313625 |
| Molecular Formula | C20H26FNO |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 4-(3-tert-butylphenoxy)-1-(4-fluorophenyl)butan-1-amine |
| SMILES | CC(C)(C)c1cccc(OCCCC(N)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H26FNO/c1-20(2,3)16-6-4-7-18(14-16)23-13-5-8-19(22)15-9-11-17(21)12-10-15/h4,6-7,9-12,14,19H,5,8,13,22H2,1-3H3 |
| InChIKey | GPXURLZNHMAUFV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|