C16H19F3O3 — CID 10313658
(2S,3S)-4-(3-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-(3,3,3-trifluoroprop-1-en-2-yl)butane-1,3-diol (PubChem CID 10313658) has the molecular formula C16H19F3O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is (2S,3S)-4-(3-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-(3,3,3-trifluoroprop-1-en-2-yl)butane-1,3-diol.
| Compound Name | (2S,3S)-4-(3-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-(3,3,3-trifluoroprop-1-en-2-yl)butane-1,3-diol |
|---|---|
| PubChem CID | 10313658 |
| Molecular Formula | C16H19F3O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2S,3S)-4-(3-methoxy-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-(3,3,3-trifluoroprop-1-en-2-yl)butane-1,3-diol |
| SMILES | C=C([C@@H](CO)[C@@H](O)CC1Cc2cc(OC)ccc21)C(F)(F)F |
| InChI | InChI=1S/C16H19F3O3/c1-9(16(17,18)19)14(8-20)15(21)7-11-5-10-6-12(22-2)3-4-13(10)11/h3-4,6,11,14-15,20-21H,1,5,7-8H2,2H3/t11?,14-,15+/m1/s1 |
| InChIKey | RNAJWMVBMSPLLK-JBAPVGOWSA-N |
| XLogP | 2.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|