C15H11BrFN3 — CID 103137126
8-N-(2-bromo-4-fluorophenyl)isoquinoline-5,8-diamine (PubChem CID 103137126) has the molecular formula C15H11BrFN3 and a molecular weight of 332.18 g/mol. Its IUPAC name is 8-N-(2-bromo-4-fluorophenyl)isoquinoline-5,8-diamine.
| Compound Name | 8-N-(2-bromo-4-fluorophenyl)isoquinoline-5,8-diamine |
|---|---|
| PubChem CID | 103137126 |
| Molecular Formula | C15H11BrFN3 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | 8-N-(2-bromo-4-fluorophenyl)isoquinoline-5,8-diamine |
| SMILES | Nc1ccc(Nc2ccc(F)cc2Br)c2cnccc12 |
| InChI | InChI=1S/C15H11BrFN3/c16-12-7-9(17)1-3-15(12)20-14-4-2-13(18)10-5-6-19-8-11(10)14/h1-8,20H,18H2 |
| InChIKey | MTEGDAMTOYSQJB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|