C11H16F2N2O — CID 103138440
(4,4-difluorocyclohexyl)-(1-methylpyrazol-3-yl)methanol (PubChem CID 103138440) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(1-methylpyrazol-3-yl)methanol.
| Compound Name | (4,4-difluorocyclohexyl)-(1-methylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 103138440 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(1-methylpyrazol-3-yl)methanol |
| SMILES | Cn1ccc(C(O)C2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C11H16F2N2O/c1-15-7-4-9(14-15)10(16)8-2-5-11(12,13)6-3-8/h4,7-8,10,16H,2-3,5-6H2,1H3 |
| InChIKey | OTAYKWWUBKVSDT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |