C17H19N3O — CID 103139051
1-isoquinolin-8-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanol (PubChem CID 103139051) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-isoquinolin-8-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanol.
| Compound Name | 1-isoquinolin-8-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 103139051 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-isoquinolin-8-yl-2-(1,3,5-trimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C)c(C)c1CC(O)c1cccc2ccncc12 |
| InChI | InChI=1S/C17H19N3O/c1-11-15(12(2)20(3)19-11)9-17(21)14-6-4-5-13-7-8-18-10-16(13)14/h4-8,10,17,21H,9H2,1-3H3 |
| InChIKey | YMCJSHSIFCNKHH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |